About 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride
2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride (PubChem CID 68981543) has the molecular formula C16H17ClN4OS
and a molecular weight of 348.86 g/mol. Its IUPAC name is 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride |
| PubChem CID | 68981543 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride |
| SMILES | COc1cc(C)ccc1-c1nc(SCc2ccccn2)n[nH]1.Cl |
| InChI | InChI=1S/C16H16N4OS.ClH/c1-11-6-7-13(14(9-11)21-2)15-18-16(20-19-15)22-10-12-5-3-4-8-17-12;/h3-9H,10H2,1-2H3,(H,18,19,20);1H |
| InChIKey | ZNTMHXYQUHLJKL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride?
The IUPAC name of 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride (CID 68981543) is 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride.
What is the SMILES notation for 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride?
The canonical SMILES for 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride is COc1cc(C)ccc1-c1nc(SCc2ccccn2)n[nH]1.Cl.
What is the InChIKey of 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride?
The InChIKey is ZNTMHXYQUHLJKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4OS.ClH/c1-11-6-7-13(14(9-11)21-2)15-18-16(20-19-15)22-10-12-5-3-4-8-17-12;/h3-9H,10H2,1-2H3,(H,18,19,20);1H.
What are the key properties of 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride?
2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride has a molecular weight of 348.86 g/mol, XLogP of 3.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2-methoxy-4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]pyridine;hydrochloride is sourced from PubChem (CID 68981543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).