C33H33NO4 — CID 68981794
2-[2-[3-[(1-oxo-1,4,4-triphenylbutan-2-yl)amino]propyl]phenoxy]acetic acid (PubChem CID 68981794) has the molecular formula C33H33NO4 and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[2-[3-[(1-oxo-1,4,4-triphenylbutan-2-yl)amino]propyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[3-[(1-oxo-1,4,4-triphenylbutan-2-yl)amino]propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 68981794 |
| Molecular Formula | C33H33NO4 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 2-[2-[3-[(1-oxo-1,4,4-triphenylbutan-2-yl)amino]propyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1CCCNC(CC(c1ccccc1)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C33H33NO4/c35-32(36)24-38-31-21-11-10-17-27(31)20-12-22-34-30(33(37)28-18-8-3-9-19-28)23-29(25-13-4-1-5-14-25)26-15-6-2-7-16-26/h1-11,13-19,21,29-30,34H,12,20,22-24H2,(H,35,36) |
| InChIKey | DBCHKSIYQNSHHZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|