C24H27ClF3N5O3 — CID 68981976
4-chloro-3-[5-methyl-3-(4-pyrrolidin-1-ylbutylamino)-1,2,4-benzotriazin-7-yl]phenol;2,2,2-trifluoroacetic acid (PubChem CID 68981976) has the molecular formula C24H27ClF3N5O3 and a molecular weight of 525.96 g/mol. Its IUPAC name is 4-chloro-3-[5-methyl-3-(4-pyrrolidin-1-ylbutylamino)-1,2,4-benzotriazin-7-yl]phenol;2,2,2-trifluoroacetic acid.
| Compound Name | 4-chloro-3-[5-methyl-3-(4-pyrrolidin-1-ylbutylamino)-1,2,4-benzotriazin-7-yl]phenol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68981976 |
| Molecular Formula | C24H27ClF3N5O3 |
| Molecular Weight | 525.96 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 4-chloro-3-[5-methyl-3-(4-pyrrolidin-1-ylbutylamino)-1,2,4-benzotriazin-7-yl]phenol;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(-c2cc(O)ccc2Cl)cc2nnc(NCCCCN3CCCC3)nc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H26ClN5O.C2HF3O2/c1-15-12-16(18-14-17(29)6-7-19(18)23)13-20-21(15)25-22(27-26-20)24-8-2-3-9-28-10-4-5-11-28;3-2(4,5)1(6)7/h6-7,12-14,29H,2-5,8-11H2,1H3,(H,24,25,27);(H,6,7) |
| InChIKey | DHTIBQDMTHDGKO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.96 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|