About 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid
3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid (PubChem CID 68982110) has the molecular formula C11H15F3O2
and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid.
Molecular Properties
| Compound Name | 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid |
| PubChem CID | 68982110 |
| Molecular Formula | C11H15F3O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O2/c1-7(10(15)16)9(11(12,13)14)8-5-3-2-4-6-8/h8H,2-6H2,1H3,(H,15,16) |
| InChIKey | FJIUIPWOTSVDPM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid?
The IUPAC name of 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid (CID 68982110) is 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid.
What is the SMILES notation for 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid?
The canonical SMILES for 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid is CC(C(=O)O)=C(C1CCCCC1)C(F)(F)F.
What is the InChIKey of 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid?
The InChIKey is FJIUIPWOTSVDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3O2/c1-7(10(15)16)9(11(12,13)14)8-5-3-2-4-6-8/h8H,2-6H2,1H3,(H,15,16).
What are the key properties of 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid?
3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid has a molecular weight of 236.23 g/mol, XLogP of 3.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-4,4,4-trifluoro-2-methylbut-2-enoic acid is sourced from PubChem (CID 68982110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).