About 1-(3,3-dimethylcyclohexyl)ethanol;formic acid
1-(3,3-dimethylcyclohexyl)ethanol;formic acid (PubChem CID 68982263) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclohexyl)ethanol;formic acid.
Molecular Properties
| Compound Name | 1-(3,3-dimethylcyclohexyl)ethanol;formic acid |
| PubChem CID | 68982263 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 1-(3,3-dimethylcyclohexyl)ethanol;formic acid |
| SMILES | CC(O)C1CCCC(C)(C)C1.O=CO |
| InChI | InChI=1S/C10H20O.CH2O2/c1-8(11)9-5-4-6-10(2,3)7-9;2-1-3/h8-9,11H,4-7H2,1-3H3;1H,(H,2,3) |
| InChIKey | QOEIPVXQYUWDJT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylcyclohexyl)ethanol;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylcyclohexyl)ethanol;formic acid?
The IUPAC name of 1-(3,3-dimethylcyclohexyl)ethanol;formic acid (CID 68982263) is 1-(3,3-dimethylcyclohexyl)ethanol;formic acid.
What is the SMILES notation for 1-(3,3-dimethylcyclohexyl)ethanol;formic acid?
The canonical SMILES for 1-(3,3-dimethylcyclohexyl)ethanol;formic acid is CC(O)C1CCCC(C)(C)C1.O=CO.
What is the InChIKey of 1-(3,3-dimethylcyclohexyl)ethanol;formic acid?
The InChIKey is QOEIPVXQYUWDJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.CH2O2/c1-8(11)9-5-4-6-10(2,3)7-9;2-1-3/h8-9,11H,4-7H2,1-3H3;1H,(H,2,3).
What are the key properties of 1-(3,3-dimethylcyclohexyl)ethanol;formic acid?
1-(3,3-dimethylcyclohexyl)ethanol;formic acid has a molecular weight of 202.29 g/mol, XLogP of 2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylcyclohexyl)ethanol;formic acid is sourced from PubChem (CID 68982263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).