C29H27NO5 — CID 68982281
(E)-3-[2-(4-methoxy-3-phenylmethoxyphenyl)-1,3-oxazol-4-yl]-1-(2-propan-2-yloxyphenyl)prop-2-en-1-one (PubChem CID 68982281) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is (E)-3-[2-(4-methoxy-3-phenylmethoxyphenyl)-1,3-oxazol-4-yl]-1-(2-propan-2-yloxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-(4-methoxy-3-phenylmethoxyphenyl)-1,3-oxazol-4-yl]-1-(2-propan-2-yloxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68982281 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (E)-3-[2-(4-methoxy-3-phenylmethoxyphenyl)-1,3-oxazol-4-yl]-1-(2-propan-2-yloxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(-c2nc(/C=C/C(=O)c3ccccc3OC(C)C)co2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H27NO5/c1-20(2)35-26-12-8-7-11-24(26)25(31)15-14-23-19-34-29(30-23)22-13-16-27(32-3)28(17-22)33-18-21-9-5-4-6-10-21/h4-17,19-20H,18H2,1-3H3/b15-14+ |
| InChIKey | PGUDRJNBLMKSPT-CCEZHUSRSA-N |
| XLogP | 6.61 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|