C39H76O9Si4 — CID 68982674
methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyphenoxy]oxane-2-carboxylate (PubChem CID 68982674) has the molecular formula C39H76O9Si4 and a molecular weight of 801.37 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyphenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyphenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 68982674 |
| Molecular Formula | C39H76O9Si4 |
| Molecular Weight | 801.37 g/mol |
| Exact Mass | 800.46 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyphenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(CO[Si](C)(C)C(C)(C)C)cc2OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H76O9Si4/c1-36(2,3)49(15,16)43-26-27-23-24-28(29(25-27)41-13)44-35-33(48-52(21,22)39(10,11)12)31(47-51(19,20)38(7,8)9)30(32(45-35)34(40)42-14)46-50(17,18)37(4,5)6/h23-25,30-33,35H,26H2,1-22H3/t30-,31+,32+,33-,35-/m1/s1 |
| InChIKey | JMRGACPFUHOJEI-ATFNGGABSA-N |
| XLogP | 10.66 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.37 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|