About 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine
4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine (PubChem CID 68983224) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine |
| PubChem CID | 68983224 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine |
| SMILES | CC(=CC1=NCCC1)CCN |
| InChI | InChI=1S/C9H16N2/c1-8(4-5-10)7-9-3-2-6-11-9/h7H,2-6,10H2,1H3 |
| InChIKey | LQVDKMNCRMHYAH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine?
The IUPAC name of 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine (CID 68983224) is 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine.
What is the SMILES notation for 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine?
The canonical SMILES for 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine is CC(=CC1=NCCC1)CCN.
What is the InChIKey of 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine?
The InChIKey is LQVDKMNCRMHYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-8(4-5-10)7-9-3-2-6-11-9/h7H,2-6,10H2,1H3.
What are the key properties of 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine?
4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine has a molecular weight of 152.24 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-2H-pyrrol-5-yl)-3-methylbut-3-en-1-amine is sourced from PubChem (CID 68983224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).