About 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide
3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide (PubChem CID 68983798) has the molecular formula C17H20BrNO
and a molecular weight of 334.26 g/mol. Its IUPAC name is 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide.
Molecular Properties
| Compound Name | 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide |
| PubChem CID | 68983798 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)C=CC1=C(Br)c2ccccc2CC1 |
| InChI | InChI=1S/C17H20BrNO/c1-3-19(4-2)16(20)12-11-14-10-9-13-7-5-6-8-15(13)17(14)18/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | YZHAFKFHAQMBEU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide?
The IUPAC name of 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide (CID 68983798) is 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide.
What is the SMILES notation for 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide?
The canonical SMILES for 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide is CCN(CC)C(=O)C=CC1=C(Br)c2ccccc2CC1.
What is the InChIKey of 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide?
The InChIKey is YZHAFKFHAQMBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20BrNO/c1-3-19(4-2)16(20)12-11-14-10-9-13-7-5-6-8-15(13)17(14)18/h5-8,11-12H,3-4,9-10H2,1-2H3.
What are the key properties of 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide?
3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide has a molecular weight of 334.26 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-bromo-3,4-dihydronaphthalen-2-yl)-N,N-diethylprop-2-enamide is sourced from PubChem (CID 68983798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).