C24H27N7O — CID 68983892
4-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-yl)-N-[3-methyl-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]pyrimidin-2-amine (PubChem CID 68983892) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-yl)-N-[3-methyl-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]pyrimidin-2-amine.
| Compound Name | 4-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-yl)-N-[3-methyl-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68983892 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 4-(3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-7-yl)-N-[3-methyl-4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]pyrimidin-2-amine |
| SMILES | Cc1cc(Nc2nccc(-c3cnc4c(c3)OCCN4)n2)ccc1N1C[C@@H]2C[C@H]1CN2C |
| InChI | InChI=1S/C24H27N7O/c1-15-9-17(3-4-21(15)31-14-18-11-19(31)13-30(18)2)28-24-26-6-5-20(29-24)16-10-22-23(27-12-16)25-7-8-32-22/h3-6,9-10,12,18-19H,7-8,11,13-14H2,1-2H3,(H,25,27)(H,26,28,29)/t18-,19-/m0/s1 |
| InChIKey | SGAJDYPHRNCUNH-OALUTQOASA-N |
| XLogP | 3.29 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |