About (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid
(2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid (PubChem CID 68985257) has the molecular formula C12H15F3N4O4
and a molecular weight of 336.27 g/mol. Its IUPAC name is (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid |
| PubChem CID | 68985257 |
| Molecular Formula | C12H15F3N4O4 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid |
| SMILES | O=C(O)N1CCN(C(=O)O)[C@H](CCn2ccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C12H15F3N4O4/c13-12(14,15)9-2-4-18(16-9)3-1-8-7-17(10(20)21)5-6-19(8)11(22)23/h2,4,8H,1,3,5-7H2,(H,20,21)(H,22,23)/t8-/m1/s1 |
| InChIKey | DGCWGSDSXOSXDS-MRVPVSSYSA-N |
| XLogP | 1.63 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid?
The IUPAC name of (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid (CID 68985257) is (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid.
What is the SMILES notation for (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid?
The canonical SMILES for (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid is O=C(O)N1CCN(C(=O)O)[C@H](CCn2ccc(C(F)(F)F)n2)C1.
What is the InChIKey of (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid?
The InChIKey is DGCWGSDSXOSXDS-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H15F3N4O4/c13-12(14,15)9-2-4-18(16-9)3-1-8-7-17(10(20)21)5-6-19(8)11(22)23/h2,4,8H,1,3,5-7H2,(H,20,21)(H,22,23)/t8-/m1/s1.
What are the key properties of (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid?
(2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid has a molecular weight of 336.27 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]piperazine-1,4-dicarboxylic acid is sourced from PubChem (CID 68985257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).