About 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide
3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide (PubChem CID 68985276) has the molecular formula C20H21ClFNOS
and a molecular weight of 377.91 g/mol. Its IUPAC name is 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide.
Molecular Properties
| Compound Name | 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide |
| PubChem CID | 68985276 |
| Molecular Formula | C20H21ClFNOS |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)C=Cc1cc(C)c(Sc2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C20H21ClFNOS/c1-4-23(5-2)20(24)11-6-15-12-14(3)19(13-18(15)21)25-17-9-7-16(22)8-10-17/h6-13H,4-5H2,1-3H3 |
| InChIKey | YDWJSUKFNPBBGH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide?
The IUPAC name of 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide (CID 68985276) is 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide.
What is the SMILES notation for 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide?
The canonical SMILES for 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide is CCN(CC)C(=O)C=Cc1cc(C)c(Sc2ccc(F)cc2)cc1Cl.
What is the InChIKey of 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide?
The InChIKey is YDWJSUKFNPBBGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClFNOS/c1-4-23(5-2)20(24)11-6-15-12-14(3)19(13-18(15)21)25-17-9-7-16(22)8-10-17/h6-13H,4-5H2,1-3H3.
What are the key properties of 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide?
3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide has a molecular weight of 377.91 g/mol, XLogP of 5.82, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N,N-diethylprop-2-enamide is sourced from PubChem (CID 68985276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).