About 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine
6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine (PubChem CID 68986659) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine.
Molecular Properties
| Compound Name | 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine |
| PubChem CID | 68986659 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine |
| SMILES | C(=C1CCCN1)C1=NCCCC1 |
| InChI | InChI=1S/C10H16N2/c1-2-6-11-9(4-1)8-10-5-3-7-12-10/h8,12H,1-7H2 |
| InChIKey | VAAWVBOLRHJVKN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine?
The IUPAC name of 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine (CID 68986659) is 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine is C(=C1CCCN1)C1=NCCCC1.
What is the InChIKey of 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine?
The InChIKey is VAAWVBOLRHJVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-2-6-11-9(4-1)8-10-5-3-7-12-10/h8,12H,1-7H2.
What are the key properties of 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine?
6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine has a molecular weight of 164.25 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(pyrrolidin-2-ylidenemethyl)-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 68986659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).