C13H15Cl3N2O4S — CID 68987110
2-piperidin-3-yloxy-2-(2,3,4-trichlorophenyl)sulfonylacetamide (PubChem CID 68987110) has the molecular formula C13H15Cl3N2O4S and a molecular weight of 401.70 g/mol. Its IUPAC name is 2-piperidin-3-yloxy-2-(2,3,4-trichlorophenyl)sulfonylacetamide.
| Compound Name | 2-piperidin-3-yloxy-2-(2,3,4-trichlorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 68987110 |
| Molecular Formula | C13H15Cl3N2O4S |
| Molecular Weight | 401.70 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 2-piperidin-3-yloxy-2-(2,3,4-trichlorophenyl)sulfonylacetamide |
| SMILES | NC(=O)C(OC1CCCNC1)S(=O)(=O)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H15Cl3N2O4S/c14-8-3-4-9(11(16)10(8)15)23(20,21)13(12(17)19)22-7-2-1-5-18-6-7/h3-4,7,13,18H,1-2,5-6H2,(H2,17,19) |
| InChIKey | MTASBPANGYHXBM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.70 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|