About (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine
(NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine (PubChem CID 6898725) has the molecular formula C8H6N2O5
and a molecular weight of 210.15 g/mol. Its IUPAC name is (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine |
| PubChem CID | 6898725 |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine |
| SMILES | O=[N+]([O-])c1cc2c(cc1/C=N/O)OCO2 |
| InChI | InChI=1S/C8H6N2O5/c11-9-3-5-1-7-8(15-4-14-7)2-6(5)10(12)13/h1-3,11H,4H2/b9-3+ |
| InChIKey | QSUKJRNTONMMNX-YCRREMRBSA-N |
| XLogP | 1.13 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine?
The IUPAC name of (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine (CID 6898725) is (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine is O=[N+]([O-])c1cc2c(cc1/C=N/O)OCO2.
What is the InChIKey of (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine?
The InChIKey is QSUKJRNTONMMNX-YCRREMRBSA-N. The full InChI is InChI=1S/C8H6N2O5/c11-9-3-5-1-7-8(15-4-14-7)2-6(5)10(12)13/h1-3,11H,4H2/b9-3+.
What are the key properties of (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine?
(NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine has a molecular weight of 210.15 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydroxylamine is sourced from PubChem (CID 6898725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).