About iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one
iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 68987480) has the molecular formula C9H12F3IN2O
and a molecular weight of 348.11 g/mol. Its IUPAC name is iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one |
| PubChem CID | 68987480 |
| Molecular Formula | C9H12F3IN2O |
| Molecular Weight | 348.11 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | CI.Cc1c(C(F)(F)F)nc(C)n(C)c1=O |
| InChI | InChI=1S/C8H9F3N2O.CH3I/c1-4-6(8(9,10)11)12-5(2)13(3)7(4)14;1-2/h1-3H3;1H3 |
| InChIKey | LQYOMPTVJNAQQZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.11 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one?
The IUPAC name of iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one (CID 68987480) is iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one.
What is the SMILES notation for iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one?
The canonical SMILES for iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one is CI.Cc1c(C(F)(F)F)nc(C)n(C)c1=O.
What is the InChIKey of iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one?
The InChIKey is LQYOMPTVJNAQQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O.CH3I/c1-4-6(8(9,10)11)12-5(2)13(3)7(4)14;1-2/h1-3H3;1H3.
What are the key properties of iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one?
iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one has a molecular weight of 348.11 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethane;2,3,5-trimethyl-6-(trifluoromethyl)pyrimidin-4-one is sourced from PubChem (CID 68987480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).