About methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline
methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline (PubChem CID 68987505) has the molecular formula C22H20N4O6
and a molecular weight of 436.42 g/mol. Its IUPAC name is methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline.
Molecular Properties
| Compound Name | methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline |
| PubChem CID | 68987505 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline |
| SMILES | COC(=O)CCc1ncc(-c2ccc([N+](=O)[O-])cc2)o1.Nc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C13H12N2O5.C9H8N2O/c1-19-13(16)7-6-12-14-8-11(20-12)9-2-4-10(5-3-9)15(17)18;10-8-3-1-7(2-4-8)9-5-11-6-12-9/h2-5,8H,6-7H2,1H3;1-6H,10H2 |
| InChIKey | WSNAUIXSDBIDKO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 147.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline?
The IUPAC name of methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline (CID 68987505) is methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline.
What is the SMILES notation for methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline?
The canonical SMILES for methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline is COC(=O)CCc1ncc(-c2ccc([N+](=O)[O-])cc2)o1.Nc1ccc(-c2cnco2)cc1.
What is the InChIKey of methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline?
The InChIKey is WSNAUIXSDBIDKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5.C9H8N2O/c1-19-13(16)7-6-12-14-8-11(20-12)9-2-4-10(5-3-9)15(17)18;10-8-3-1-7(2-4-8)9-5-11-6-12-9/h2-5,8H,6-7H2,1H3;1-6H,10H2.
What are the key properties of methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline?
methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline has a molecular weight of 436.42 g/mol, XLogP of 4.28, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-(4-nitrophenyl)-1,3-oxazol-2-yl]propanoate;4-(1,3-oxazol-5-yl)aniline is sourced from PubChem (CID 68987505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).