C25H24F3N7 — CID 68987741
N-[3-methyl-4-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-2-amine (PubChem CID 68987741) has the molecular formula C25H24F3N7 and a molecular weight of 479.51 g/mol. Its IUPAC name is N-[3-methyl-4-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-2-amine.
| Compound Name | N-[3-methyl-4-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 68987741 |
| Molecular Formula | C25H24F3N7 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[3-methyl-4-[(1S,4S)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(Nc2nccc(-c3cnc4[nH]ccc4c3)n2)ccc1N1C[C@@H]2C[C@H]1CN2CC(F)(F)F |
| InChI | InChI=1S/C25H24F3N7/c1-15-8-18(2-3-22(15)35-13-19-10-20(35)12-34(19)14-25(26,27)28)32-24-30-7-5-21(33-24)17-9-16-4-6-29-23(16)31-11-17/h2-9,11,19-20H,10,12-14H2,1H3,(H,29,31)(H,30,32,33)/t19-,20-/m0/s1 |
| InChIKey | XUQQRMJHJQJMML-PMACEKPBSA-N |
| XLogP | 4.90 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |