About (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid
(3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid (PubChem CID 68987824) has the molecular formula C15H20N4O3
and a molecular weight of 304.35 g/mol. Its IUPAC name is (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid |
| PubChem CID | 68987824 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid |
| SMILES | Cc1nc2cc(NCC[C@@H]3CN(C(=O)O)CCN3)ccc2o1 |
| InChI | InChI=1S/C15H20N4O3/c1-10-18-13-8-11(2-3-14(13)22-10)16-5-4-12-9-19(15(20)21)7-6-17-12/h2-3,8,12,16-17H,4-7,9H2,1H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | YAQRLWVPNLKUBB-GFCCVEGCSA-N |
| XLogP | 1.89 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid?
The IUPAC name of (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid (CID 68987824) is (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid.
What is the SMILES notation for (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid?
The canonical SMILES for (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid is Cc1nc2cc(NCC[C@@H]3CN(C(=O)O)CCN3)ccc2o1.
What is the InChIKey of (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid?
The InChIKey is YAQRLWVPNLKUBB-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H20N4O3/c1-10-18-13-8-11(2-3-14(13)22-10)16-5-4-12-9-19(15(20)21)7-6-17-12/h2-3,8,12,16-17H,4-7,9H2,1H3,(H,20,21)/t12-/m1/s1.
What are the key properties of (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid?
(3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid has a molecular weight of 304.35 g/mol, XLogP of 1.89, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[2-[(2-methyl-1,3-benzoxazol-5-yl)amino]ethyl]piperazine-1-carboxylic acid is sourced from PubChem (CID 68987824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).