About N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide
N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide (PubChem CID 68988911) has the molecular formula C22H23FN4O2
and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide |
| PubChem CID | 68988911 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2CCN(C(c3ccccc3)c3ncco3)CC2)c(F)c1 |
| InChI | InChI=1S/C22H23FN4O2/c1-16(28)25-18-7-8-20(19(23)15-18)26-10-12-27(13-11-26)21(22-24-9-14-29-22)17-5-3-2-4-6-17/h2-9,14-15,21H,10-13H2,1H3,(H,25,28) |
| InChIKey | GOORYJVRKVTISP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide?
The IUPAC name of N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide (CID 68988911) is N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide.
What is the SMILES notation for N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide?
The canonical SMILES for N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide is CC(=O)Nc1ccc(N2CCN(C(c3ccccc3)c3ncco3)CC2)c(F)c1.
What is the InChIKey of N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide?
The InChIKey is GOORYJVRKVTISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23FN4O2/c1-16(28)25-18-7-8-20(19(23)15-18)26-10-12-27(13-11-26)21(22-24-9-14-29-22)17-5-3-2-4-6-17/h2-9,14-15,21H,10-13H2,1H3,(H,25,28).
What are the key properties of N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide?
N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide has a molecular weight of 394.45 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-fluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]acetamide is sourced from PubChem (CID 68988911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).