C8H17ClN2O2 — CID 68989076
(1-ethylpiperidin-4-yl)carbamic acid;hydrochloride (PubChem CID 68989076) has the molecular formula C8H17ClN2O2 and a molecular weight of 208.69 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl)carbamic acid;hydrochloride.
| Compound Name | (1-ethylpiperidin-4-yl)carbamic acid;hydrochloride |
|---|---|
| PubChem CID | 68989076 |
| Molecular Formula | C8H17ClN2O2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (1-ethylpiperidin-4-yl)carbamic acid;hydrochloride |
| SMILES | CCN1CCC(NC(=O)O)CC1.Cl |
| InChI | InChI=1S/C8H16N2O2.ClH/c1-2-10-5-3-7(4-6-10)9-8(11)12;/h7,9H,2-6H2,1H3,(H,11,12);1H |
| InChIKey | HQUQGKOACGBODQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |