C20H22F2N4O6S — CID 68989216
1,1-difluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide (PubChem CID 68989216) has the molecular formula C20H22F2N4O6S and a molecular weight of 484.48 g/mol. Its IUPAC name is 1,1-difluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 68989216 |
| Molecular Formula | C20H22F2N4O6S |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 1,1-difluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)C(F)F)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C20H22F2N4O6S/c1-30-12-10-15(17(16(11-12)31-2)32-9-5-8-27)25-18-19(26-33(28,29)20(21)22)24-14-7-4-3-6-13(14)23-18/h3-4,6-7,10-11,20,27H,5,8-9H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | OBHUIUZKNRPMKM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|