C32H31N5O7 — CID 68989843
4-anilino-2,3-bis[(2R)-4-benzyl-3,6-dioxopiperazin-2-yl]-4-oxobutanoic acid (PubChem CID 68989843) has the molecular formula C32H31N5O7 and a molecular weight of 597.63 g/mol. Its IUPAC name is 4-anilino-2,3-bis[(2R)-4-benzyl-3,6-dioxopiperazin-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-anilino-2,3-bis[(2R)-4-benzyl-3,6-dioxopiperazin-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68989843 |
| Molecular Formula | C32H31N5O7 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 4-anilino-2,3-bis[(2R)-4-benzyl-3,6-dioxopiperazin-2-yl]-4-oxobutanoic acid |
| SMILES | O=C1CN(Cc2ccccc2)C(=O)[C@@H](C(C(=O)O)C(C(=O)Nc2ccccc2)[C@H]2NC(=O)CN(Cc3ccccc3)C2=O)N1 |
| InChI | InChI=1S/C32H31N5O7/c38-23-18-36(16-20-10-4-1-5-11-20)30(41)27(34-23)25(29(40)33-22-14-8-3-9-15-22)26(32(43)44)28-31(42)37(19-24(39)35-28)17-21-12-6-2-7-13-21/h1-15,25-28H,16-19H2,(H,33,40)(H,34,38)(H,35,39)(H,43,44)/t25?,26?,27-,28-/m1/s1 |
| InChIKey | TVMVOBZQOYPVDX-XQOSCOKLSA-N |
| XLogP | 1.00 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |