C25H30FN3O2 — CID 68990366
2-[4-[(5S)-7-(3-fluoropropyl)-2,7-diazaspiro[4.4]nonan-2-yl]phenyl]-6-hydroxy-3,4-dihydroisoquinolin-1-one (PubChem CID 68990366) has the molecular formula C25H30FN3O2 and a molecular weight of 423.53 g/mol. Its IUPAC name is 2-[4-[(5S)-7-(3-fluoropropyl)-2,7-diazaspiro[4.4]nonan-2-yl]phenyl]-6-hydroxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[4-[(5S)-7-(3-fluoropropyl)-2,7-diazaspiro[4.4]nonan-2-yl]phenyl]-6-hydroxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 68990366 |
| Molecular Formula | C25H30FN3O2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-[4-[(5S)-7-(3-fluoropropyl)-2,7-diazaspiro[4.4]nonan-2-yl]phenyl]-6-hydroxy-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccc(O)cc2CCN1c1ccc(N2CC[C@]3(CCN(CCCF)C3)C2)cc1 |
| InChI | InChI=1S/C25H30FN3O2/c26-11-1-12-27-14-9-25(17-27)10-15-28(18-25)20-2-4-21(5-3-20)29-13-8-19-16-22(30)6-7-23(19)24(29)31/h2-7,16,30H,1,8-15,17-18H2/t25-/m0/s1 |
| InChIKey | ZRFVJBSAADGUBZ-VWLOTQADSA-N |
| XLogP | 3.86 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|