About [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone
[6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone (PubChem CID 68990379) has the molecular formula C21H25FN4O2
and a molecular weight of 384.46 g/mol. Its IUPAC name is [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone |
| PubChem CID | 68990379 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cccc(N2CCCNCC2)n1)N1CCC(Oc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H25FN4O2/c22-16-5-7-17(8-6-16)28-18-9-13-26(15-18)21(27)19-3-1-4-20(24-19)25-12-2-10-23-11-14-25/h1,3-8,18,23H,2,9-15H2 |
| InChIKey | WBKUFFSISHAZNM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone?
The IUPAC name of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone (CID 68990379) is [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone.
What is the SMILES notation for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone?
The canonical SMILES for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone is O=C(c1cccc(N2CCCNCC2)n1)N1CCC(Oc2ccc(F)cc2)C1.
What is the InChIKey of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone?
The InChIKey is WBKUFFSISHAZNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25FN4O2/c22-16-5-7-17(8-6-16)28-18-9-13-26(15-18)21(27)19-3-1-4-20(24-19)25-12-2-10-23-11-14-25/h1,3-8,18,23H,2,9-15H2.
What are the key properties of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone?
[6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone has a molecular weight of 384.46 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[3-(4-fluorophenoxy)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 68990379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).