C24H24BrN3O2 — CID 6899054
N-[(E)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-2-bromobenzamide (PubChem CID 6899054) has the molecular formula C24H24BrN3O2 and a molecular weight of 466.38 g/mol. Its IUPAC name is N-[(E)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-2-bromobenzamide.
| Compound Name | N-[(E)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-2-bromobenzamide |
|---|---|
| PubChem CID | 6899054 |
| Molecular Formula | C24H24BrN3O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[(E)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-2-bromobenzamide |
| SMILES | O=C(N/N=C/C1=C(N2CCOCC2)/C(=C\c2ccccc2)CC1)c1ccccc1Br |
| InChI | InChI=1S/C24H24BrN3O2/c25-22-9-5-4-8-21(22)24(29)27-26-17-20-11-10-19(16-18-6-2-1-3-7-18)23(20)28-12-14-30-15-13-28/h1-9,16-17H,10-15H2,(H,27,29)/b19-16-,26-17+ |
| InChIKey | MOMZXAQNNHYUOV-HRDZTEILSA-N |
| XLogP | 4.63 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|