C17H20O — CID 68990586
(4aR)-1,1,4a-trimethyl-7,8-dihydro-6H-phenanthren-2-one (PubChem CID 68990586) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (4aR)-1,1,4a-trimethyl-7,8-dihydro-6H-phenanthren-2-one.
| Compound Name | (4aR)-1,1,4a-trimethyl-7,8-dihydro-6H-phenanthren-2-one |
|---|---|
| PubChem CID | 68990586 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (4aR)-1,1,4a-trimethyl-7,8-dihydro-6H-phenanthren-2-one |
| SMILES | CC1(C)C(=O)C=C[C@]2(C)C3=CCCCC3=CC=C12 |
| InChI | InChI=1S/C17H20O/c1-16(2)14-9-8-12-6-4-5-7-13(12)17(14,3)11-10-15(16)18/h7-11H,4-6H2,1-3H3/t17-/m1/s1 |
| InChIKey | AUHJJYIMTJFDEG-QGZVFWFLSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |