C30H36N4O2 — CID 68990733
[(2R)-2-benzylpiperazin-1-yl]-[5-phenyl-1-[(1S,2S)-2-prop-2-enoxycyclohexyl]imidazol-4-yl]methanone (PubChem CID 68990733) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is [(2R)-2-benzylpiperazin-1-yl]-[5-phenyl-1-[(1S,2S)-2-prop-2-enoxycyclohexyl]imidazol-4-yl]methanone.
| Compound Name | [(2R)-2-benzylpiperazin-1-yl]-[5-phenyl-1-[(1S,2S)-2-prop-2-enoxycyclohexyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 68990733 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | [(2R)-2-benzylpiperazin-1-yl]-[5-phenyl-1-[(1S,2S)-2-prop-2-enoxycyclohexyl]imidazol-4-yl]methanone |
| SMILES | C=CCO[C@H]1CCCC[C@@H]1n1cnc(C(=O)N2CCNC[C@H]2Cc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H36N4O2/c1-2-19-36-27-16-10-9-15-26(27)34-22-32-28(29(34)24-13-7-4-8-14-24)30(35)33-18-17-31-21-25(33)20-23-11-5-3-6-12-23/h2-8,11-14,22,25-27,31H,1,9-10,15-21H2/t25-,26+,27+/m1/s1 |
| InChIKey | POIFZTYGEJTQAJ-PVHODMMVSA-N |
| XLogP | 4.89 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|