C10H16N2O5S3 — CID 68990769
(4S,6S)-4-(ethylamino)-6-methyl-1,7,7-trioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 68990769) has the molecular formula C10H16N2O5S3 and a molecular weight of 340.45 g/mol. Its IUPAC name is (4S,6S)-4-(ethylamino)-6-methyl-1,7,7-trioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | (4S,6S)-4-(ethylamino)-6-methyl-1,7,7-trioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 68990769 |
| Molecular Formula | C10H16N2O5S3 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (4S,6S)-4-(ethylamino)-6-methyl-1,7,7-trioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCN[C@H]1C[C@H](C)S(=O)(=O)C2=C1C=C(S(N)(=O)=O)S2=O |
| InChI | InChI=1S/C10H16N2O5S3/c1-3-12-8-4-6(2)19(14,15)10-7(8)5-9(18(10)13)20(11,16)17/h5-6,8,12H,3-4H2,1-2H3,(H2,11,16,17)/t6-,8-,18?/m0/s1 |
| InChIKey | PBVMLKLAYNIKSO-IKPSDJLYSA-N |
| XLogP | -0.72 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |