C23H21F3N6O2S — CID 68990933
4-[5-(3-propan-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorophenyl)-1,3-thiazol-2-yl]piperidine-1-carboxylic acid (PubChem CID 68990933) has the molecular formula C23H21F3N6O2S and a molecular weight of 502.52 g/mol. Its IUPAC name is 4-[5-(3-propan-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorophenyl)-1,3-thiazol-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[5-(3-propan-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorophenyl)-1,3-thiazol-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68990933 |
| Molecular Formula | C23H21F3N6O2S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 4-[5-(3-propan-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorophenyl)-1,3-thiazol-2-yl]piperidine-1-carboxylic acid |
| SMILES | CC(C)c1nnc2ccc(-c3sc(C4CCN(C(=O)O)CC4)nc3-c3cc(F)c(F)cc3F)nn12 |
| InChI | InChI=1S/C23H21F3N6O2S/c1-11(2)21-29-28-18-4-3-17(30-32(18)21)20-19(13-9-15(25)16(26)10-14(13)24)27-22(35-20)12-5-7-31(8-6-12)23(33)34/h3-4,9-12H,5-8H2,1-2H3,(H,33,34) |
| InChIKey | SZOMBCUXAFAJGD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|