About (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid
(2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid (PubChem CID 68992233) has the molecular formula C16H24N4O7
and a molecular weight of 384.39 g/mol. Its IUPAC name is (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid |
| PubChem CID | 68992233 |
| Molecular Formula | C16H24N4O7 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid |
| SMILES | CCn1cc(CC(=O)OC)c(OCC[C@@H]2CN(C(=O)O)CCN2C(=O)O)n1 |
| InChI | InChI=1S/C16H24N4O7/c1-3-19-9-11(8-13(21)26-2)14(17-19)27-7-4-12-10-18(15(22)23)5-6-20(12)16(24)25/h9,12H,3-8,10H2,1-2H3,(H,22,23)(H,24,25)/t12-/m1/s1 |
| InChIKey | LISHXIQMISMMIK-GFCCVEGCSA-N |
| XLogP | 0.73 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid?
The IUPAC name of (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid (CID 68992233) is (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid.
What is the SMILES notation for (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid?
The canonical SMILES for (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid is CCn1cc(CC(=O)OC)c(OCC[C@@H]2CN(C(=O)O)CCN2C(=O)O)n1.
What is the InChIKey of (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid?
The InChIKey is LISHXIQMISMMIK-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H24N4O7/c1-3-19-9-11(8-13(21)26-2)14(17-19)27-7-4-12-10-18(15(22)23)5-6-20(12)16(24)25/h9,12H,3-8,10H2,1-2H3,(H,22,23)(H,24,25)/t12-/m1/s1.
What are the key properties of (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid?
(2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid has a molecular weight of 384.39 g/mol, XLogP of 0.73, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2-[1-ethyl-4-(2-methoxy-2-oxoethyl)pyrazol-3-yl]oxyethyl]piperazine-1,4-dicarboxylic acid is sourced from PubChem (CID 68992233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).