C13H10F3NO5 — CID 68992261
4,4,4-trifluoro-1-(8-methoxy-3-oxo-4H-1,4-benzoxazin-6-yl)butane-1,3-dione (PubChem CID 68992261) has the molecular formula C13H10F3NO5 and a molecular weight of 317.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(8-methoxy-3-oxo-4H-1,4-benzoxazin-6-yl)butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-(8-methoxy-3-oxo-4H-1,4-benzoxazin-6-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 68992261 |
| Molecular Formula | C13H10F3NO5 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4,4,4-trifluoro-1-(8-methoxy-3-oxo-4H-1,4-benzoxazin-6-yl)butane-1,3-dione |
| SMILES | COc1cc(C(=O)CC(=O)C(F)(F)F)cc2c1OCC(=O)N2 |
| InChI | InChI=1S/C13H10F3NO5/c1-21-9-3-6(8(18)4-10(19)13(14,15)16)2-7-12(9)22-5-11(20)17-7/h2-3H,4-5H2,1H3,(H,17,20) |
| InChIKey | BYVNGXYKYOOWPS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|