About 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate
2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 68992552) has the molecular formula C14H22INO5
and a molecular weight of 411.24 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate |
| PubChem CID | 68992552 |
| Molecular Formula | C14H22INO5 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CCC1(C(=O)OC(C)(C)C)CC(C)(C)C(=O)N1C(=O)OI |
| InChI | InChI=1S/C14H22INO5/c1-7-14(10(18)20-12(2,3)4)8-13(5,6)9(17)16(14)11(19)21-15/h7-8H2,1-6H3 |
| InChIKey | GLPUWPVGCWXTLB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate (CID 68992552) is 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate is CCC1(C(=O)OC(C)(C)C)CC(C)(C)C(=O)N1C(=O)OI.
What is the InChIKey of 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate?
The InChIKey is GLPUWPVGCWXTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22INO5/c1-7-14(10(18)20-12(2,3)4)8-13(5,6)9(17)16(14)11(19)21-15/h7-8H2,1-6H3.
What are the key properties of 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate?
2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate has a molecular weight of 411.24 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-tert-butyl 1-O-iodo 2-ethyl-4,4-dimethyl-5-oxopyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 68992552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).