C18H23NO6 — CID 68992633
5-O-tert-butyl 4-O-methyl 2-phenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate (PubChem CID 68992633) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 5-O-tert-butyl 4-O-methyl 2-phenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 4-O-methyl 2-phenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 68992633 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 5-O-tert-butyl 4-O-methyl 2-phenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate |
| SMILES | COC(=O)C1C2OC(c3ccccc3)OC2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23NO6/c1-18(2,3)25-17(21)19-10-12-14(13(19)15(20)22-4)24-16(23-12)11-8-6-5-7-9-11/h5-9,12-14,16H,10H2,1-4H3 |
| InChIKey | FFRVMBHGPYFJHC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |