About 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate
3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate (PubChem CID 68992691) has the molecular formula C16H20F3NO5
and a molecular weight of 363.33 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate |
| PubChem CID | 68992691 |
| Molecular Formula | C16H20F3NO5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1cnc(C(F)(F)F)c(OC)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20F3NO5/c1-15(2,3)25-14(22)10(13(21)24-5)6-9-7-11(23-4)12(20-8-9)16(17,18)19/h7-8,10H,6H2,1-5H3 |
| InChIKey | GYBGYKGHLSSFLR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate (CID 68992691) is 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate is COC(=O)C(Cc1cnc(C(F)(F)F)c(OC)c1)C(=O)OC(C)(C)C.
What is the InChIKey of 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate?
The InChIKey is GYBGYKGHLSSFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F3NO5/c1-15(2,3)25-14(22)10(13(21)24-5)6-9-7-11(23-4)12(20-8-9)16(17,18)19/h7-8,10H,6H2,1-5H3.
What are the key properties of 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate?
3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate has a molecular weight of 363.33 g/mol, XLogP of 2.78, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-methyl 2-[[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]methyl]propanedioate is sourced from PubChem (CID 68992691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).