C28H32N6O9 — CID 68993659
but-2-enedioic acid;6-[[[(3S,4S)-4-hydroxy-1-[2-(7-methoxy-2-oxo-1,5-naphthyridin-1-yl)ethyl]pyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 68993659) has the molecular formula C28H32N6O9 and a molecular weight of 596.60 g/mol. Its IUPAC name is but-2-enedioic acid;6-[[[(3S,4S)-4-hydroxy-1-[2-(7-methoxy-2-oxo-1,5-naphthyridin-1-yl)ethyl]pyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | but-2-enedioic acid;6-[[[(3S,4S)-4-hydroxy-1-[2-(7-methoxy-2-oxo-1,5-naphthyridin-1-yl)ethyl]pyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 68993659 |
| Molecular Formula | C28H32N6O9 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | but-2-enedioic acid;6-[[[(3S,4S)-4-hydroxy-1-[2-(7-methoxy-2-oxo-1,5-naphthyridin-1-yl)ethyl]pyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1cnc2ccc(=O)n(CCN3C[C@H](CNCc4ccc5c(n4)NC(=O)CO5)[C@H](O)C3)c2c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C24H28N6O5.C4H4O4/c1-34-17-8-19-18(26-11-17)3-5-23(33)30(19)7-6-29-12-15(20(31)13-29)9-25-10-16-2-4-21-24(27-16)28-22(32)14-35-21;5-3(6)1-2-4(7)8/h2-5,8,11,15,20,25,31H,6-7,9-10,12-14H2,1H3,(H,27,28,32);1-2H,(H,5,6)(H,7,8)/t15-,20+;/m0./s1 |
| InChIKey | GDNWJCBDKOOCJJ-ICCPGPOKSA-N |
| XLogP | -0.07 |
| TPSA | 205.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|