C15H23NO4 — CID 68993805
2-O-tert-butyl 1-O-methyl 1,3,3a,4,7,7a-hexahydroisoindole-1,2-dicarboxylate (PubChem CID 68993805) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-methyl 1,3,3a,4,7,7a-hexahydroisoindole-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-methyl 1,3,3a,4,7,7a-hexahydroisoindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 68993805 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-O-tert-butyl 1-O-methyl 1,3,3a,4,7,7a-hexahydroisoindole-1,2-dicarboxylate |
| SMILES | COC(=O)C1C2CC=CCC2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)20-14(18)16-9-10-7-5-6-8-11(10)12(16)13(17)19-4/h5-6,10-12H,7-9H2,1-4H3 |
| InChIKey | DRTWTCJWDYTJEK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|