C23H30BrClN2O2 — CID 68994104
2-[(5-bromo-2-methoxyphenyl)-[piperidin-3-yl(propyl)amino]methyl]-3-chloro-6-methylphenol (PubChem CID 68994104) has the molecular formula C23H30BrClN2O2 and a molecular weight of 481.86 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)-[piperidin-3-yl(propyl)amino]methyl]-3-chloro-6-methylphenol.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)-[piperidin-3-yl(propyl)amino]methyl]-3-chloro-6-methylphenol |
|---|---|
| PubChem CID | 68994104 |
| Molecular Formula | C23H30BrClN2O2 |
| Molecular Weight | 481.86 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)-[piperidin-3-yl(propyl)amino]methyl]-3-chloro-6-methylphenol |
| SMILES | CCCN(C1CCCNC1)C(c1cc(Br)ccc1OC)c1c(Cl)ccc(C)c1O |
| InChI | InChI=1S/C23H30BrClN2O2/c1-4-12-27(17-6-5-11-26-14-17)22(18-13-16(24)8-10-20(18)29-3)21-19(25)9-7-15(2)23(21)28/h7-10,13,17,22,26,28H,4-6,11-12,14H2,1-3H3 |
| InChIKey | JCICTNQNMOOZHY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|