About 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole]
1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole] (PubChem CID 68994775) has the molecular formula C17H22ClN3O
and a molecular weight of 319.84 g/mol. Its IUPAC name is 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole].
Molecular Properties
| Compound Name | 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole] |
| PubChem CID | 68994775 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole] |
| SMILES | CCOC1=NN(c2ccc(Cl)cc2)C2(C1)CN1CCC2CC1 |
| InChI | InChI=1S/C17H22ClN3O/c1-2-22-16-11-17(12-20-9-7-13(17)8-10-20)21(19-16)15-5-3-14(18)4-6-15/h3-6,13H,2,7-12H2,1H3 |
| InChIKey | JKASWBIEMHHTMY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole]?
The IUPAC name of 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole] (CID 68994775) is 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole].
What is the SMILES notation for 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole]?
The canonical SMILES for 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole] is CCOC1=NN(c2ccc(Cl)cc2)C2(C1)CN1CCC2CC1.
What is the InChIKey of 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole]?
The InChIKey is JKASWBIEMHHTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN3O/c1-2-22-16-11-17(12-20-9-7-13(17)8-10-20)21(19-16)15-5-3-14(18)4-6-15/h3-6,13H,2,7-12H2,1H3.
What are the key properties of 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole]?
1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole] has a molecular weight of 319.84 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(4-chlorophenyl)-3'-ethoxyspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-pyrazole] is sourced from PubChem (CID 68994775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).