C17H21N3O3 — CID 68994981
9-[3-(dimethylamino)propyl]-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indole-6-carboxylic acid (PubChem CID 68994981) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 9-[3-(dimethylamino)propyl]-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indole-6-carboxylic acid.
| Compound Name | 9-[3-(dimethylamino)propyl]-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 68994981 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 9-[3-(dimethylamino)propyl]-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indole-6-carboxylic acid |
| SMILES | CN(C)CCCn1c2c(c3cc(C(=O)O)ccc31)CCNC2=O |
| InChI | InChI=1S/C17H21N3O3/c1-19(2)8-3-9-20-14-5-4-11(17(22)23)10-13(14)12-6-7-18-16(21)15(12)20/h4-5,10H,3,6-9H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | PJJQLSIXZWEQPF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|