C23H29N3O6S2 — CID 68995192
N-[(1R,2S)-2-[[3-phenylmethoxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]methyl]cyclohexyl]methanesulfonamide (PubChem CID 68995192) has the molecular formula C23H29N3O6S2 and a molecular weight of 507.63 g/mol. Its IUPAC name is N-[(1R,2S)-2-[[3-phenylmethoxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]methyl]cyclohexyl]methanesulfonamide.
| Compound Name | N-[(1R,2S)-2-[[3-phenylmethoxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]methyl]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 68995192 |
| Molecular Formula | C23H29N3O6S2 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | N-[(1R,2S)-2-[[3-phenylmethoxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]methyl]cyclohexyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCCC[C@H]1Cc1ccc(N2CC(=O)NS2(=O)=O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H29N3O6S2/c1-33(28,29)24-20-10-6-5-9-19(20)13-18-11-12-21(26-15-23(27)25-34(26,30)31)22(14-18)32-16-17-7-3-2-4-8-17/h2-4,7-8,11-12,14,19-20,24H,5-6,9-10,13,15-16H2,1H3,(H,25,27)/t19-,20+/m0/s1 |
| InChIKey | WLSHCQPHQJNLHL-VQTJNVASSA-N |
| XLogP | 2.10 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |