C26H30FN5O4 — CID 68995201
(2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-[2-[1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethylamino]pentanoic acid (PubChem CID 68995201) has the molecular formula C26H30FN5O4 and a molecular weight of 495.56 g/mol. Its IUPAC name is (2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-[2-[1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethylamino]pentanoic acid.
| Compound Name | (2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-[2-[1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 68995201 |
| Molecular Formula | C26H30FN5O4 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (2S)-5-[(N,N'-dimethylcarbamimidoyl)amino]-2-[2-[1-(5-fluoro-2-oxo-1H-indol-3-ylidene)-3H-2-benzofuran-5-yl]ethylamino]pentanoic acid |
| SMILES | C/N=C(\NC)NCCC[C@H](NCCc1ccc2c(c1)COC2=C1C(=O)Nc2ccc(F)cc21)C(=O)O |
| InChI | InChI=1S/C26H30FN5O4/c1-28-26(29-2)31-10-3-4-21(25(34)35)30-11-9-15-5-7-18-16(12-15)14-36-23(18)22-19-13-17(27)6-8-20(19)32-24(22)33/h5-8,12-13,21,30H,3-4,9-11,14H2,1-2H3,(H,32,33)(H,34,35)(H2,28,29,31)/t21-/m0/s1 |
| InChIKey | FDEAKWSPWDAHPA-NRFANRHFSA-N |
| XLogP | 2.34 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|