About 2,5-dibromobenzene-1,4-dithiol
2,5-dibromobenzene-1,4-dithiol (PubChem CID 68995334) has the molecular formula C6H4Br2S2
and a molecular weight of 300.04 g/mol. Its IUPAC name is 2,5-dibromobenzene-1,4-dithiol.
Molecular Properties
| Compound Name | 2,5-dibromobenzene-1,4-dithiol |
| PubChem CID | 68995334 |
| Molecular Formula | C6H4Br2S2 |
| Molecular Weight | 300.04 g/mol |
| Exact Mass | 297.81 |
| IUPAC Name | 2,5-dibromobenzene-1,4-dithiol |
| SMILES | Sc1cc(Br)c(S)cc1Br |
| InChI | InChI=1S/C6H4Br2S2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H |
| InChIKey | XYSWBCRMOWBCBS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.04 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromobenzene-1,4-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromobenzene-1,4-dithiol?
The IUPAC name of 2,5-dibromobenzene-1,4-dithiol (CID 68995334) is 2,5-dibromobenzene-1,4-dithiol.
What is the SMILES notation for 2,5-dibromobenzene-1,4-dithiol?
The canonical SMILES for 2,5-dibromobenzene-1,4-dithiol is Sc1cc(Br)c(S)cc1Br.
What is the InChIKey of 2,5-dibromobenzene-1,4-dithiol?
The InChIKey is XYSWBCRMOWBCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2S2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H.
What are the key properties of 2,5-dibromobenzene-1,4-dithiol?
2,5-dibromobenzene-1,4-dithiol has a molecular weight of 300.04 g/mol, XLogP of 3.79, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromobenzene-1,4-dithiol is sourced from PubChem (CID 68995334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).