About 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline
4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline (PubChem CID 68995370) has the molecular formula C23H21N3O
and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline.
Molecular Properties
| Compound Name | 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline |
| PubChem CID | 68995370 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline |
| SMILES | CN1Cc2cc(-c3cccnn3)ccc2C(C)(c2ccc3occc3c2)C1 |
| InChI | InChI=1S/C23H21N3O/c1-23(19-6-8-22-17(13-19)9-11-27-22)15-26(2)14-18-12-16(5-7-20(18)23)21-4-3-10-24-25-21/h3-13H,14-15H2,1-2H3 |
| InChIKey | IYXKLLQFFRYXOF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline?
The IUPAC name of 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline (CID 68995370) is 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline.
What is the SMILES notation for 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline?
The canonical SMILES for 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline is CN1Cc2cc(-c3cccnn3)ccc2C(C)(c2ccc3occc3c2)C1.
What is the InChIKey of 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline?
The InChIKey is IYXKLLQFFRYXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O/c1-23(19-6-8-22-17(13-19)9-11-27-22)15-26(2)14-18-12-16(5-7-20(18)23)21-4-3-10-24-25-21/h3-13H,14-15H2,1-2H3.
What are the key properties of 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline?
4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline has a molecular weight of 355.44 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzofuran-5-yl)-2,4-dimethyl-7-pyridazin-3-yl-1,3-dihydroisoquinoline is sourced from PubChem (CID 68995370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).