About (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid
(4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid (PubChem CID 68995751) has the molecular formula C25H24N2O2
and a molecular weight of 384.48 g/mol. Its IUPAC name is (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid |
| PubChem CID | 68995751 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)N=C(Cc2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2/c1-25(24(28)29)23(21-15-9-4-10-16-21)27(18-20-13-7-3-8-14-20)22(26-25)17-19-11-5-2-6-12-19/h2-16,23H,17-18H2,1H3,(H,28,29)/t23-,25+/m1/s1 |
| InChIKey | VZMQXGYNKYKQEK-NOZRDPDXSA-N |
| XLogP | 4.73 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid?
The IUPAC name of (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid (CID 68995751) is (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid.
What is the SMILES notation for (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid?
The canonical SMILES for (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid is C[C@]1(C(=O)O)N=C(Cc2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccccc1.
What is the InChIKey of (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid?
The InChIKey is VZMQXGYNKYKQEK-NOZRDPDXSA-N. The full InChI is InChI=1S/C25H24N2O2/c1-25(24(28)29)23(21-15-9-4-10-16-21)27(18-20-13-7-3-8-14-20)22(26-25)17-19-11-5-2-6-12-19/h2-16,23H,17-18H2,1H3,(H,28,29)/t23-,25+/m1/s1.
What are the key properties of (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid?
(4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid has a molecular weight of 384.48 g/mol, XLogP of 4.73, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-2,3-dibenzyl-5-methyl-4-phenyl-4H-imidazole-5-carboxylic acid is sourced from PubChem (CID 68995751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).