C21H26N4O6S — CID 6899594
1,3-bis[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]thiourea (PubChem CID 6899594) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is 1,3-bis[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1,3-bis[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6899594 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 1,3-bis[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(/C=N/NC(=S)N/N=C/c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N4O6S/c1-26-15-7-13(8-16(27-2)19(15)30-5)11-22-24-21(32)25-23-12-14-9-17(28-3)20(31-6)18(10-14)29-4/h7-12H,1-6H3,(H2,24,25,32)/b22-11+,23-12+ |
| InChIKey | FVDYLAUVYKMISU-LCHFAGMQSA-N |
| XLogP | 2.57 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|