About 2-aminoacetamide;1H-benzimidazole
2-aminoacetamide;1H-benzimidazole (PubChem CID 68996084) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-aminoacetamide;1H-benzimidazole.
Molecular Properties
| Compound Name | 2-aminoacetamide;1H-benzimidazole |
| PubChem CID | 68996084 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-aminoacetamide;1H-benzimidazole |
| SMILES | NCC(N)=O.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C2H6N2O/c1-2-4-7-6(3-1)8-5-9-7;3-1-2(4)5/h1-5H,(H,8,9);1,3H2,(H2,4,5) |
| InChIKey | MXYVYEYDNBPAOI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoacetamide;1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetamide;1H-benzimidazole?
The IUPAC name of 2-aminoacetamide;1H-benzimidazole (CID 68996084) is 2-aminoacetamide;1H-benzimidazole.
What is the SMILES notation for 2-aminoacetamide;1H-benzimidazole?
The canonical SMILES for 2-aminoacetamide;1H-benzimidazole is NCC(N)=O.c1ccc2[nH]cnc2c1.
What is the InChIKey of 2-aminoacetamide;1H-benzimidazole?
The InChIKey is MXYVYEYDNBPAOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C2H6N2O/c1-2-4-7-6(3-1)8-5-9-7;3-1-2(4)5/h1-5H,(H,8,9);1,3H2,(H2,4,5).
What are the key properties of 2-aminoacetamide;1H-benzimidazole?
2-aminoacetamide;1H-benzimidazole has a molecular weight of 192.22 g/mol, XLogP of -0.01, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetamide;1H-benzimidazole is sourced from PubChem (CID 68996084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).