C27H48NO2P — CID 68996341
[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]phosphonous acid (PubChem CID 68996341) has the molecular formula C27H48NO2P and a molecular weight of 449.66 g/mol. Its IUPAC name is [[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]phosphonous acid.
| Compound Name | [[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]phosphonous acid |
|---|---|
| PubChem CID | 68996341 |
| Molecular Formula | C27H48NO2P |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.34 |
| IUPAC Name | [[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]phosphonous acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4CC(NP(O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H48NO2P/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28-31(29)30)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28-30H,6-8,10-17H2,1-5H3/t19-,21?,22?,23-,24?,25?,26+,27-/m1/s1 |
| InChIKey | LTTMAPCDZKQTCH-XXTMWSIOSA-N |
| XLogP | 7.20 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|