C16H15N3 — CID 68996719
4-(1H-indazol-6-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 68996719) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-(1H-indazol-6-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 4-(1H-indazol-6-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 68996719 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4-(1H-indazol-6-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CNCC2c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C16H15N3/c1-2-4-14-12(3-1)8-17-10-15(14)11-5-6-13-9-18-19-16(13)7-11/h1-7,9,15,17H,8,10H2,(H,18,19) |
| InChIKey | QTWKHCIFFJHSPI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |