C21H31N5O — CID 6899705
3-(4-methylpiperazin-1-yl)-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]propanamide (PubChem CID 6899705) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]propanamide.
| Compound Name | 3-(4-methylpiperazin-1-yl)-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]propanamide |
|---|---|
| PubChem CID | 6899705 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]propanamide |
| SMILES | CN1CCN(CCC(=O)N/N=C/C=C2\N(C)c3ccccc3C2(C)C)CC1 |
| InChI | InChI=1S/C21H31N5O/c1-21(2)17-7-5-6-8-18(17)25(4)19(21)9-11-22-23-20(27)10-12-26-15-13-24(3)14-16-26/h5-9,11H,10,12-16H2,1-4H3,(H,23,27)/b19-9-,22-11+ |
| InChIKey | OJCJZAFPTSPAFZ-VMKFXXQGSA-N |
| XLogP | 2.04 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|